C22H17F3N6O2S — CID 146528223
1-pyridin-2-yl-N-[2,3,6-trifluoro-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]methanesulfinamide (PubChem CID 146528223) has the molecular formula C22H17F3N6O2S and a molecular weight of 486.48 g/mol. Its IUPAC name is 1-pyridin-2-yl-N-[2,3,6-trifluoro-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]methanesulfinamide.
| Compound Name | 1-pyridin-2-yl-N-[2,3,6-trifluoro-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]methanesulfinamide |
|---|---|
| PubChem CID | 146528223 |
| Molecular Formula | C22H17F3N6O2S |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 1-pyridin-2-yl-N-[2,3,6-trifluoro-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]methanesulfinamide |
| SMILES | CNc1nccc(-c2cccnc2Oc2cc(F)c(NS(=O)Cc3ccccn3)c(F)c2F)n1 |
| InChI | InChI=1S/C22H17F3N6O2S/c1-26-22-29-10-7-16(30-22)14-6-4-9-28-21(14)33-17-11-15(23)20(19(25)18(17)24)31-34(32)12-13-5-2-3-8-27-13/h2-11,31H,12H2,1H3,(H,26,29,30) |
| InChIKey | HZWIIXKKWPMSCB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|