C20H18F5N5O2S — CID 146529253
3,3-difluoro-N-[2,3,6-trifluoro-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]butane-1-sulfinamide (PubChem CID 146529253) has the molecular formula C20H18F5N5O2S and a molecular weight of 487.45 g/mol. Its IUPAC name is 3,3-difluoro-N-[2,3,6-trifluoro-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]butane-1-sulfinamide.
| Compound Name | 3,3-difluoro-N-[2,3,6-trifluoro-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]butane-1-sulfinamide |
|---|---|
| PubChem CID | 146529253 |
| Molecular Formula | C20H18F5N5O2S |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 3,3-difluoro-N-[2,3,6-trifluoro-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]butane-1-sulfinamide |
| SMILES | CNc1nccc(-c2cccnc2Oc2cc(F)c(NS(=O)CCC(C)(F)F)c(F)c2F)n1 |
| InChI | InChI=1S/C20H18F5N5O2S/c1-20(24,25)6-9-33(31)30-17-12(21)10-14(15(22)16(17)23)32-18-11(4-3-7-27-18)13-5-8-28-19(26-2)29-13/h3-5,7-8,10,30H,6,9H2,1-2H3,(H,26,28,29) |
| InChIKey | AJYKWFHWMMDEIE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|