C19H22BrFN2 — CID 146529572
(2R,5S)-1-[(2-bromophenyl)-(4-fluorophenyl)methyl]-2,5-dimethylpiperazine (PubChem CID 146529572) has the molecular formula C19H22BrFN2 and a molecular weight of 377.30 g/mol. Its IUPAC name is (2R,5S)-1-[(2-bromophenyl)-(4-fluorophenyl)methyl]-2,5-dimethylpiperazine.
| Compound Name | (2R,5S)-1-[(2-bromophenyl)-(4-fluorophenyl)methyl]-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 146529572 |
| Molecular Formula | C19H22BrFN2 |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (2R,5S)-1-[(2-bromophenyl)-(4-fluorophenyl)methyl]-2,5-dimethylpiperazine |
| SMILES | C[C@@H]1CN[C@@H](C)CN1C(c1ccc(F)cc1)c1ccccc1Br |
| InChI | InChI=1S/C19H22BrFN2/c1-13-12-23(14(2)11-22-13)19(15-7-9-16(21)10-8-15)17-5-3-4-6-18(17)20/h3-10,13-14,19,22H,11-12H2,1-2H3/t13-,14+,19?/m0/s1 |
| InChIKey | YGXIRGPUIKCUDB-PFCANICASA-N |
| XLogP | 4.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |