C19H24N2O — CID 56974492
3-[(R)-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-phenylmethyl]phenol (PubChem CID 56974492) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-[(R)-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-phenylmethyl]phenol.
| Compound Name | 3-[(R)-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-phenylmethyl]phenol |
|---|---|
| PubChem CID | 56974492 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 3-[(R)-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-phenylmethyl]phenol |
| SMILES | C[C@@H]1CN(C(c2ccccc2)c2cccc(O)c2)[C@@H](C)CN1 |
| InChI | InChI=1S/C19H24N2O/c1-14-13-21(15(2)12-20-14)19(16-7-4-3-5-8-16)17-9-6-10-18(22)11-17/h3-11,14-15,19-20,22H,12-13H2,1-2H3/t14-,15+,19?/m1/s1 |
| InChIKey | HWGUPANSJKQFNP-DALSXFDMSA-N |
| XLogP | 3.16 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |