C21H21N5O4S2 — CID 146530023
5-(2,1,3-benzothiadiazol-5-ylsulfonyl)-N-[(2-methoxyphenyl)methyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide (PubChem CID 146530023) has the molecular formula C21H21N5O4S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is 5-(2,1,3-benzothiadiazol-5-ylsulfonyl)-N-[(2-methoxyphenyl)methyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide.
| Compound Name | 5-(2,1,3-benzothiadiazol-5-ylsulfonyl)-N-[(2-methoxyphenyl)methyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 146530023 |
| Molecular Formula | C21H21N5O4S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 5-(2,1,3-benzothiadiazol-5-ylsulfonyl)-N-[(2-methoxyphenyl)methyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide |
| SMILES | COc1ccccc1CNC(=O)N1CC2=C(C1)CN(S(=O)(=O)c1ccc3nsnc3c1)C2 |
| InChI | InChI=1S/C21H21N5O4S2/c1-30-20-5-3-2-4-14(20)9-22-21(27)25-10-15-12-26(13-16(15)11-25)32(28,29)17-6-7-18-19(8-17)24-31-23-18/h2-8H,9-13H2,1H3,(H,22,27) |
| InChIKey | OWRXMIHEPATAPB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|