C23H37N — CID 146530215
4-[2-(4-cyclohexylphenyl)propan-2-yl]-1-propan-2-ylpiperidine (PubChem CID 146530215) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is 4-[2-(4-cyclohexylphenyl)propan-2-yl]-1-propan-2-ylpiperidine.
| Compound Name | 4-[2-(4-cyclohexylphenyl)propan-2-yl]-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 146530215 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 4-[2-(4-cyclohexylphenyl)propan-2-yl]-1-propan-2-ylpiperidine |
| SMILES | CC(C)N1CCC(C(C)(C)c2ccc(C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C23H37N/c1-18(2)24-16-14-22(15-17-24)23(3,4)21-12-10-20(11-13-21)19-8-6-5-7-9-19/h10-13,18-19,22H,5-9,14-17H2,1-4H3 |
| InChIKey | LPGTWKBJZFEHAP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |