C19H18FN3O3S — CID 146530247
2-(4-fluorophenyl)-1-(5-pyridin-3-ylsulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl)ethanone (PubChem CID 146530247) has the molecular formula C19H18FN3O3S and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-(5-pyridin-3-ylsulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl)ethanone.
| Compound Name | 2-(4-fluorophenyl)-1-(5-pyridin-3-ylsulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 146530247 |
| Molecular Formula | C19H18FN3O3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-(4-fluorophenyl)-1-(5-pyridin-3-ylsulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)N1CC2=C(C1)CN(S(=O)(=O)c1cccnc1)C2 |
| InChI | InChI=1S/C19H18FN3O3S/c20-17-5-3-14(4-6-17)8-19(24)22-10-15-12-23(13-16(15)11-22)27(25,26)18-2-1-7-21-9-18/h1-7,9H,8,10-13H2 |
| InChIKey | UZVRGMWWUDNMAJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|