C6H9F3N2O3 — CID 146530860
methyl 2-[carbamoyl(2,2,2-trifluoroethyl)amino]acetate (PubChem CID 146530860) has the molecular formula C6H9F3N2O3 and a molecular weight of 214.14 g/mol. Its IUPAC name is methyl 2-[carbamoyl(2,2,2-trifluoroethyl)amino]acetate.
| Compound Name | methyl 2-[carbamoyl(2,2,2-trifluoroethyl)amino]acetate |
|---|---|
| PubChem CID | 146530860 |
| Molecular Formula | C6H9F3N2O3 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | methyl 2-[carbamoyl(2,2,2-trifluoroethyl)amino]acetate |
| SMILES | COC(=O)CN(CC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C6H9F3N2O3/c1-14-4(12)2-11(5(10)13)3-6(7,8)9/h2-3H2,1H3,(H2,10,13) |
| InChIKey | SSZLDOMPNUKCRB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |