C15H21N — CID 146531668
2-(1-ethenylcyclopentyl)-N,N-dimethylaniline (PubChem CID 146531668) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-(1-ethenylcyclopentyl)-N,N-dimethylaniline.
| Compound Name | 2-(1-ethenylcyclopentyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 146531668 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 2-(1-ethenylcyclopentyl)-N,N-dimethylaniline |
| SMILES | C=CC1(c2ccccc2N(C)C)CCCC1 |
| InChI | InChI=1S/C15H21N/c1-4-15(11-7-8-12-15)13-9-5-6-10-14(13)16(2)3/h4-6,9-10H,1,7-8,11-12H2,2-3H3 |
| InChIKey | ZDTRZSSQWYILFS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|