C23H33ClO6 — CID 146534895
[3-(1-chloro-2-methylpropoxy)-2-(2,2-dimethylpent-4-ynoyloxymethyl)-2-methyl-3-oxopropyl] 2,2-dimethylpent-4-ynoate (PubChem CID 146534895) has the molecular formula C23H33ClO6 and a molecular weight of 440.96 g/mol. Its IUPAC name is [3-(1-chloro-2-methylpropoxy)-2-(2,2-dimethylpent-4-ynoyloxymethyl)-2-methyl-3-oxopropyl] 2,2-dimethylpent-4-ynoate.
| Compound Name | [3-(1-chloro-2-methylpropoxy)-2-(2,2-dimethylpent-4-ynoyloxymethyl)-2-methyl-3-oxopropyl] 2,2-dimethylpent-4-ynoate |
|---|---|
| PubChem CID | 146534895 |
| Molecular Formula | C23H33ClO6 |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [3-(1-chloro-2-methylpropoxy)-2-(2,2-dimethylpent-4-ynoyloxymethyl)-2-methyl-3-oxopropyl] 2,2-dimethylpent-4-ynoate |
| SMILES | C#CCC(C)(C)C(=O)OCC(C)(COC(=O)C(C)(C)CC#C)C(=O)OC(Cl)C(C)C |
| InChI | InChI=1S/C23H33ClO6/c1-10-12-21(5,6)18(25)28-14-23(9,20(27)30-17(24)16(3)4)15-29-19(26)22(7,8)13-11-2/h1-2,16-17H,12-15H2,3-9H3 |
| InChIKey | KQEUBBFXNUDPGE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|