C18H26O4 — CID 146484013
3-(2,2-dimethylpent-4-ynoyloxy)butyl 2,2-dimethylpent-4-ynoate (PubChem CID 146484013) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 3-(2,2-dimethylpent-4-ynoyloxy)butyl 2,2-dimethylpent-4-ynoate.
| Compound Name | 3-(2,2-dimethylpent-4-ynoyloxy)butyl 2,2-dimethylpent-4-ynoate |
|---|---|
| PubChem CID | 146484013 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 3-(2,2-dimethylpent-4-ynoyloxy)butyl 2,2-dimethylpent-4-ynoate |
| SMILES | C#CCC(C)(C)C(=O)OCCC(C)OC(=O)C(C)(C)CC#C |
| InChI | InChI=1S/C18H26O4/c1-8-11-17(4,5)15(19)21-13-10-14(3)22-16(20)18(6,7)12-9-2/h1-2,14H,10-13H2,3-7H3 |
| InChIKey | PLPDXQHPBCZABA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|