C17H32O3 — CID 89367538
[(2R)-4-(3-methylhex-5-en-3-yloxy)butan-2-yl] 2,2-dimethylbutanoate (PubChem CID 89367538) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is [(2R)-4-(3-methylhex-5-en-3-yloxy)butan-2-yl] 2,2-dimethylbutanoate.
| Compound Name | [(2R)-4-(3-methylhex-5-en-3-yloxy)butan-2-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 89367538 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | [(2R)-4-(3-methylhex-5-en-3-yloxy)butan-2-yl] 2,2-dimethylbutanoate |
| SMILES | C=CCC(C)(CC)OCC[C@@H](C)OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C17H32O3/c1-8-12-17(7,10-3)19-13-11-14(4)20-15(18)16(5,6)9-2/h8,14H,1,9-13H2,2-7H3/t14-,17?/m1/s1 |
| InChIKey | GRSCZHYIMXZVTR-XPCCGILXSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|