C12H16O5 — CID 87806321
2-(4-methylhepta-1,6-dien-4-yloxymethylidene)propanedioic acid (PubChem CID 87806321) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is 2-(4-methylhepta-1,6-dien-4-yloxymethylidene)propanedioic acid.
| Compound Name | 2-(4-methylhepta-1,6-dien-4-yloxymethylidene)propanedioic acid |
|---|---|
| PubChem CID | 87806321 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-(4-methylhepta-1,6-dien-4-yloxymethylidene)propanedioic acid |
| SMILES | C=CCC(C)(CC=C)OC=C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H16O5/c1-4-6-12(3,7-5-2)17-8-9(10(13)14)11(15)16/h4-5,8H,1-2,6-7H2,3H3,(H,13,14)(H,15,16) |
| InChIKey | UMJGQWHMTOFJGJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|