C12H21NO — CID 146536218
4-tert-butyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine (PubChem CID 146536218) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-tert-butyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine.
| Compound Name | 4-tert-butyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 146536218 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4-tert-butyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)(C)C1=CCN(C2COC2)CC1 |
| InChI | InChI=1S/C12H21NO/c1-12(2,3)10-4-6-13(7-5-10)11-8-14-9-11/h4,11H,5-9H2,1-3H3 |
| InChIKey | QEPOTOKVJFBCQQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|