C41H35Br — CID 146536643
6-bromo-21-tert-butyl-13-(4-tert-butylphenyl)-16-methylheptacyclo[12.10.1.13,7.02,12.018,25.019,24.011,26]hexacosa-1,3(26),4,6,8,10,12,14,16,18(25),19(24),20,22-tridecaene (PubChem CID 146536643) has the molecular formula C41H35Br and a molecular weight of 607.64 g/mol. Its IUPAC name is 6-bromo-21-tert-butyl-13-(4-tert-butylphenyl)-16-methylheptacyclo[12.10.1.13,7.02,12.018,25.019,24.011,26]hexacosa-1,3(26),4,6,8,10,12,14,16,18(25),19(24),20,22-tridecaene.
| Compound Name | 6-bromo-21-tert-butyl-13-(4-tert-butylphenyl)-16-methylheptacyclo[12.10.1.13,7.02,12.018,25.019,24.011,26]hexacosa-1,3(26),4,6,8,10,12,14,16,18(25),19(24),20,22-tridecaene |
|---|---|
| PubChem CID | 146536643 |
| Molecular Formula | C41H35Br |
| Molecular Weight | 607.64 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | 6-bromo-21-tert-butyl-13-(4-tert-butylphenyl)-16-methylheptacyclo[12.10.1.13,7.02,12.018,25.019,24.011,26]hexacosa-1,3(26),4,6,8,10,12,14,16,18(25),19(24),20,22-tridecaene |
| SMILES | Cc1cc2c(-c3ccc(C(C)(C)C)cc3)c3c4cccc5c(Br)ccc(c54)c3c3c4ccc(C(C)(C)C)cc4c(c1)c23 |
| InChI | InChI=1S/C41H35Br/c1-22-19-31-30-21-25(41(5,6)7)15-16-26(30)37-36(31)32(20-22)34(23-11-13-24(14-12-23)40(2,3)4)38-28-10-8-9-27-33(42)18-17-29(35(27)28)39(37)38/h8-21H,1-7H3 |
| InChIKey | DRAABWKOPBQACE-UHFFFAOYSA-N |
| XLogP | 12.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.64 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |