C6H12FN — CID 146537502
(E)-4-fluoro-N,2-dimethylbut-1-en-1-amine (PubChem CID 146537502) has the molecular formula C6H12FN and a molecular weight of 117.17 g/mol. Its IUPAC name is (E)-4-fluoro-N,2-dimethylbut-1-en-1-amine.
| Compound Name | (E)-4-fluoro-N,2-dimethylbut-1-en-1-amine |
|---|---|
| PubChem CID | 146537502 |
| Molecular Formula | C6H12FN |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.10 |
| IUPAC Name | (E)-4-fluoro-N,2-dimethylbut-1-en-1-amine |
| SMILES | CN/C=C(\C)CCF |
| InChI | InChI=1S/C6H12FN/c1-6(3-4-7)5-8-2/h5,8H,3-4H2,1-2H3/b6-5+ |
| InChIKey | IHBAOYFWDQEKHS-AATRIKPKSA-N |
| XLogP | 1.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |