C22H24FN7O3S2 — CID 146538759
5-[5-[2-[2-(6-ethyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]-2-fluorophenol (PubChem CID 146538759) has the molecular formula C22H24FN7O3S2 and a molecular weight of 517.61 g/mol. Its IUPAC name is 5-[5-[2-[2-(6-ethyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]-2-fluorophenol.
| Compound Name | 5-[5-[2-[2-(6-ethyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]-2-fluorophenol |
|---|---|
| PubChem CID | 146538759 |
| Molecular Formula | C22H24FN7O3S2 |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 5-[5-[2-[2-(6-ethyl-1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]-2-fluorophenol |
| SMILES | CCN1CCCN(CCNc2nccc(-c3c(-c4ccc(F)c(O)c4)nc4sccn34)n2)S1(=O)=O |
| InChI | InChI=1S/C22H24FN7O3S2/c1-2-28-9-3-10-29(35(28,32)33)11-8-25-21-24-7-6-17(26-21)20-19(27-22-30(20)12-13-34-22)15-4-5-16(23)18(31)14-15/h4-7,12-14,31H,2-3,8-11H2,1H3,(H,24,25,26) |
| InChIKey | JJBZBTRMJLJGTK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |