C21H23N7O3S2 — CID 138631859
4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[2-(5-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]pyrimidin-2-amine (PubChem CID 138631859) has the molecular formula C21H23N7O3S2 and a molecular weight of 485.60 g/mol. Its IUPAC name is 4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[2-(5-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]pyrimidin-2-amine.
| Compound Name | 4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[2-(5-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 138631859 |
| Molecular Formula | C21H23N7O3S2 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[2-(5-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]pyrimidin-2-amine |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCN3CCN(C)S3(=O)=O)n2)c1 |
| InChI | InChI=1S/C21H23N7O3S2/c1-26-10-11-27(33(26,29)30)9-8-23-20-22-7-6-17(24-20)19-18(25-21-28(19)12-13-32-21)15-4-3-5-16(14-15)31-2/h3-7,12-14H,8-11H2,1-2H3,(H,22,23,24) |
| InChIKey | WFTAGVVIUQANFH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |