C25H23N5O3S2 — CID 158265657
N-[3-(benzenesulfonyl)propyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine (PubChem CID 158265657) has the molecular formula C25H23N5O3S2 and a molecular weight of 505.63 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)propyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine.
| Compound Name | N-[3-(benzenesulfonyl)propyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 158265657 |
| Molecular Formula | C25H23N5O3S2 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | N-[3-(benzenesulfonyl)propyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCCS(=O)(=O)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C25H23N5O3S2/c1-33-19-8-5-7-18(17-19)22-23(30-14-15-34-25(30)29-22)21-11-13-27-24(28-21)26-12-6-16-35(31,32)20-9-3-2-4-10-20/h2-5,7-11,13-15,17H,6,12,16H2,1H3,(H,26,27,28) |
| InChIKey | GIKGFVFFDVTBFJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|