C24H20FN5O3S2 — CID 148741083
3-[5-[2-[3-(4-fluorophenyl)sulfonylpropylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol (PubChem CID 148741083) has the molecular formula C24H20FN5O3S2 and a molecular weight of 509.59 g/mol. Its IUPAC name is 3-[5-[2-[3-(4-fluorophenyl)sulfonylpropylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol.
| Compound Name | 3-[5-[2-[3-(4-fluorophenyl)sulfonylpropylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol |
|---|---|
| PubChem CID | 148741083 |
| Molecular Formula | C24H20FN5O3S2 |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 3-[5-[2-[3-(4-fluorophenyl)sulfonylpropylamino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenol |
| SMILES | O=S(=O)(CCCNc1nccc(-c2c(-c3cccc(O)c3)nc3sccn23)n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H20FN5O3S2/c25-17-5-7-19(8-6-17)35(32,33)14-2-10-26-23-27-11-9-20(28-23)22-21(16-3-1-4-18(31)15-16)29-24-30(22)12-13-34-24/h1,3-9,11-13,15,31H,2,10,14H2,(H,26,27,28) |
| InChIKey | OCVTZVNQPKJHNP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 109.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|