C25H20F3N7O4S2 — CID 165368150
N-[3-[[4-[6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]propyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 165368150) has the molecular formula C25H20F3N7O4S2 and a molecular weight of 603.61 g/mol. Its IUPAC name is N-[3-[[4-[6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]propyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-[[4-[6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]propyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 165368150 |
| Molecular Formula | C25H20F3N7O4S2 |
| Molecular Weight | 603.61 g/mol |
| Exact Mass | 603.10 |
| IUPAC Name | N-[3-[[4-[6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]propyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(-c2nc3sccn3c2-c2ccnc(NCCCNS(=O)(=O)c3ccc(C(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C25H20F3N7O4S2/c26-25(27,28)17-5-7-19(8-6-17)41(38,39)31-11-2-10-29-23-30-12-9-20(32-23)22-21(33-24-34(22)13-14-40-24)16-3-1-4-18(15-16)35(36)37/h1,3-9,12-15,31H,2,10-11H2,(H,29,30,32) |
| InChIKey | WLXWJPJHMQQSCS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|