About (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate
(2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate (PubChem CID 146539005) has the molecular formula C20H15NO6
and a molecular weight of 365.34 g/mol. Its IUPAC name is (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate.
Molecular Properties
| Compound Name | (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate |
| PubChem CID | 146539005 |
| Molecular Formula | C20H15NO6 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate |
| SMILES | Cc1cccnc1C(=O)c1c(C=O)oc(C)c1C(=O)Oc1ccccc1O |
| InChI | InChI=1S/C20H15NO6/c1-11-6-5-9-21-18(11)19(24)17-15(10-22)26-12(2)16(17)20(25)27-14-8-4-3-7-13(14)23/h3-10,23H,1-2H3 |
| InChIKey | GHJNOMLUPKNBBO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate?
The IUPAC name of (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate (CID 146539005) is (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate.
What is the SMILES notation for (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate?
The canonical SMILES for (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate is Cc1cccnc1C(=O)c1c(C=O)oc(C)c1C(=O)Oc1ccccc1O.
What is the InChIKey of (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate?
The InChIKey is GHJNOMLUPKNBBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO6/c1-11-6-5-9-21-18(11)19(24)17-15(10-22)26-12(2)16(17)20(25)27-14-8-4-3-7-13(14)23/h3-10,23H,1-2H3.
What are the key properties of (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate?
(2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate has a molecular weight of 365.34 g/mol, XLogP of 3.26, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyphenyl) 5-formyl-2-methyl-4-(3-methylpyridine-2-carbonyl)furan-3-carboxylate is sourced from PubChem (CID 146539005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).