About 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+)
3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+) (PubChem CID 10058713) has the molecular formula C7H7NO3V+2
and a molecular weight of 204.08 g/mol. Its IUPAC name is 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+).
Molecular Properties
| Compound Name | 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+) |
| PubChem CID | 10058713 |
| Molecular Formula | C7H7NO3V+2 |
| Molecular Weight | 204.08 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+) |
| SMILES | Cc1cccnc1C(=O)O.[O-2].[V+4] |
| InChI | InChI=1S/C7H7NO2.O.V/c1-5-3-2-4-8-6(5)7(9)10;;/h2-4H,1H3,(H,9,10);;/q;-2;+4 |
| InChIKey | OSDGEKPTAZFPGJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.08 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+)?
The IUPAC name of 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+) (CID 10058713) is 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+).
What is the SMILES notation for 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+)?
The canonical SMILES for 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+) is Cc1cccnc1C(=O)O.[O-2].[V+4].
What is the InChIKey of 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+)?
The InChIKey is OSDGEKPTAZFPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.O.V/c1-5-3-2-4-8-6(5)7(9)10;;/h2-4H,1H3,(H,9,10);;/q;-2;+4.
What are the key properties of 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+)?
3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+) has a molecular weight of 204.08 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpyridine-2-carboxylic acid;oxygen(2-);vanadium(4+) is sourced from PubChem (CID 10058713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).