About ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid
ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid (PubChem CID 178019084) has the molecular formula C19H27NO4
and a molecular weight of 333.43 g/mol. Its IUPAC name is ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid |
| PubChem CID | 178019084 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid |
| SMILES | CC.CC.Cc1ccc(C(=O)O)cc1.Cc1cccnc1C(=O)O |
| InChI | InChI=1S/C8H8O2.C7H7NO2.2C2H6/c1-6-2-4-7(5-3-6)8(9)10;1-5-3-2-4-8-6(5)7(9)10;2*1-2/h2-5H,1H3,(H,9,10);2-4H,1H3,(H,9,10);2*1-2H3 |
| InChIKey | HVCLIFZMKOVNJW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid?
The IUPAC name of ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid (CID 178019084) is ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid.
What is the SMILES notation for ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid?
The canonical SMILES for ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid is CC.CC.Cc1ccc(C(=O)O)cc1.Cc1cccnc1C(=O)O.
What is the InChIKey of ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid?
The InChIKey is HVCLIFZMKOVNJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C7H7NO2.2C2H6/c1-6-2-4-7(5-3-6)8(9)10;1-5-3-2-4-8-6(5)7(9)10;2*1-2/h2-5H,1H3,(H,9,10);2-4H,1H3,(H,9,10);2*1-2H3.
What are the key properties of ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid?
ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid has a molecular weight of 333.43 g/mol, XLogP of 4.83, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methylbenzoic acid;3-methylpyridine-2-carboxylic acid is sourced from PubChem (CID 178019084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).