About 4-pyrimidin-2-ylbenzoic acid;hydrochloride
4-pyrimidin-2-ylbenzoic acid;hydrochloride (PubChem CID 45117414) has the molecular formula C11H9ClN2O2
and a molecular weight of 236.66 g/mol. Its IUPAC name is 4-pyrimidin-2-ylbenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-pyrimidin-2-ylbenzoic acid;hydrochloride |
| PubChem CID | 45117414 |
| Molecular Formula | C11H9ClN2O2 |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 4-pyrimidin-2-ylbenzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(-c2ncccn2)cc1 |
| InChI | InChI=1S/C11H8N2O2.ClH/c14-11(15)9-4-2-8(3-5-9)10-12-6-1-7-13-10;/h1-7H,(H,14,15);1H |
| InChIKey | DERLEQHDSMQZTP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-pyrimidin-2-ylbenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrimidin-2-ylbenzoic acid;hydrochloride?
The IUPAC name of 4-pyrimidin-2-ylbenzoic acid;hydrochloride (CID 45117414) is 4-pyrimidin-2-ylbenzoic acid;hydrochloride.
What is the SMILES notation for 4-pyrimidin-2-ylbenzoic acid;hydrochloride?
The canonical SMILES for 4-pyrimidin-2-ylbenzoic acid;hydrochloride is Cl.O=C(O)c1ccc(-c2ncccn2)cc1.
What is the InChIKey of 4-pyrimidin-2-ylbenzoic acid;hydrochloride?
The InChIKey is DERLEQHDSMQZTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2.ClH/c14-11(15)9-4-2-8(3-5-9)10-12-6-1-7-13-10;/h1-7H,(H,14,15);1H.
What are the key properties of 4-pyrimidin-2-ylbenzoic acid;hydrochloride?
4-pyrimidin-2-ylbenzoic acid;hydrochloride has a molecular weight of 236.66 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrimidin-2-ylbenzoic acid;hydrochloride is sourced from PubChem (CID 45117414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).