C41H34N4 — CID 146544168
3-[(1E,3E)-2,4-bis(2,7-dimethylcarbazol-9-yl)-1-(methylideneamino)penta-1,3-dien-3-yl]benzonitrile (PubChem CID 146544168) has the molecular formula C41H34N4 and a molecular weight of 582.75 g/mol. Its IUPAC name is 3-[(1E,3E)-2,4-bis(2,7-dimethylcarbazol-9-yl)-1-(methylideneamino)penta-1,3-dien-3-yl]benzonitrile.
| Compound Name | 3-[(1E,3E)-2,4-bis(2,7-dimethylcarbazol-9-yl)-1-(methylideneamino)penta-1,3-dien-3-yl]benzonitrile |
|---|---|
| PubChem CID | 146544168 |
| Molecular Formula | C41H34N4 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 3-[(1E,3E)-2,4-bis(2,7-dimethylcarbazol-9-yl)-1-(methylideneamino)penta-1,3-dien-3-yl]benzonitrile |
| SMILES | C=N/C=C(C(=C(/C)n1c2cc(C)ccc2c2ccc(C)cc21)\c1cccc(C#N)c1)/n1c2cc(C)ccc2c2ccc(C)cc21 |
| InChI | InChI=1S/C41H34N4/c1-25-10-14-32-33-15-11-26(2)19-37(33)44(36(32)18-25)29(5)41(31-9-7-8-30(22-31)23-42)40(24-43-6)45-38-20-27(3)12-16-34(38)35-17-13-28(4)21-39(35)45/h7-22,24H,6H2,1-5H3/b40-24+,41-29+ |
| InChIKey | YYOPLCBNYTWIKQ-NYLINFGCSA-N |
| XLogP | 10.60 |
| TPSA | 46.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|