C18H11BrClF2NO3S — CID 146546023
5-bromo-3-chloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide (PubChem CID 146546023) has the molecular formula C18H11BrClF2NO3S and a molecular weight of 474.71 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide.
| Compound Name | 5-bromo-3-chloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 146546023 |
| Molecular Formula | C18H11BrClF2NO3S |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 472.93 |
| IUPAC Name | 5-bromo-3-chloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccccc2)c(F)cc1F)c1cc(Br)cc(Cl)c1O |
| InChI | InChI=1S/C18H11BrClF2NO3S/c19-11-6-13(20)18(24)17(7-11)27(25,26)23-16-8-12(14(21)9-15(16)22)10-4-2-1-3-5-10/h1-9,23-24H |
| InChIKey | SLSHRCTZKYGANN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|