C19H15BrClNO4S — CID 146546028
3-bromo-5-chloro-2-hydroxy-N-(2-methoxy-5-phenylphenyl)benzenesulfonamide (PubChem CID 146546028) has the molecular formula C19H15BrClNO4S and a molecular weight of 468.76 g/mol. Its IUPAC name is 3-bromo-5-chloro-2-hydroxy-N-(2-methoxy-5-phenylphenyl)benzenesulfonamide.
| Compound Name | 3-bromo-5-chloro-2-hydroxy-N-(2-methoxy-5-phenylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 146546028 |
| Molecular Formula | C19H15BrClNO4S |
| Molecular Weight | 468.76 g/mol |
| Exact Mass | 466.96 |
| IUPAC Name | 3-bromo-5-chloro-2-hydroxy-N-(2-methoxy-5-phenylphenyl)benzenesulfonamide |
| SMILES | COc1ccc(-c2ccccc2)cc1NS(=O)(=O)c1cc(Cl)cc(Br)c1O |
| InChI | InChI=1S/C19H15BrClNO4S/c1-26-17-8-7-13(12-5-3-2-4-6-12)9-16(17)22-27(24,25)18-11-14(21)10-15(20)19(18)23/h2-11,22-23H,1H3 |
| InChIKey | GCDLNXZQQGAZDD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.76 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|