C20H17Cl2NO4S — CID 146601013
3,5-dichloro-2-hydroxy-N-[2-methoxy-5-(3-methylphenyl)phenyl]benzenesulfonamide (PubChem CID 146601013) has the molecular formula C20H17Cl2NO4S and a molecular weight of 438.33 g/mol. Its IUPAC name is 3,5-dichloro-2-hydroxy-N-[2-methoxy-5-(3-methylphenyl)phenyl]benzenesulfonamide.
| Compound Name | 3,5-dichloro-2-hydroxy-N-[2-methoxy-5-(3-methylphenyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 146601013 |
| Molecular Formula | C20H17Cl2NO4S |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 3,5-dichloro-2-hydroxy-N-[2-methoxy-5-(3-methylphenyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2cccc(C)c2)cc1NS(=O)(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C20H17Cl2NO4S/c1-12-4-3-5-13(8-12)14-6-7-18(27-2)17(9-14)23-28(25,26)19-11-15(21)10-16(22)20(19)24/h3-11,23-24H,1-2H3 |
| InChIKey | NPIKMLRSJMEHHP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|