C20H15Cl2NO6S — CID 146545909
2-[2-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-4-phenylphenoxy]acetic acid (PubChem CID 146545909) has the molecular formula C20H15Cl2NO6S and a molecular weight of 468.31 g/mol. Its IUPAC name is 2-[2-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-4-phenylphenoxy]acetic acid.
| Compound Name | 2-[2-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-4-phenylphenoxy]acetic acid |
|---|---|
| PubChem CID | 146545909 |
| Molecular Formula | C20H15Cl2NO6S |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 2-[2-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-4-phenylphenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(-c2ccccc2)cc1NS(=O)(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C20H15Cl2NO6S/c21-14-9-15(22)20(26)18(10-14)30(27,28)23-16-8-13(12-4-2-1-3-5-12)6-7-17(16)29-11-19(24)25/h1-10,23,26H,11H2,(H,24,25) |
| InChIKey | ZQFYRUSVZNJFCQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|