C19H15Cl2NO4S — CID 155568772
3,5-dichloro-2-hydroxy-N-[2-(4-methoxyphenyl)phenyl]benzenesulfonamide (PubChem CID 155568772) has the molecular formula C19H15Cl2NO4S and a molecular weight of 424.31 g/mol. Its IUPAC name is 3,5-dichloro-2-hydroxy-N-[2-(4-methoxyphenyl)phenyl]benzenesulfonamide.
| Compound Name | 3,5-dichloro-2-hydroxy-N-[2-(4-methoxyphenyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155568772 |
| Molecular Formula | C19H15Cl2NO4S |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 3,5-dichloro-2-hydroxy-N-[2-(4-methoxyphenyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2ccccc2NS(=O)(=O)c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C19H15Cl2NO4S/c1-26-14-8-6-12(7-9-14)15-4-2-3-5-17(15)22-27(24,25)18-11-13(20)10-16(21)19(18)23/h2-11,22-23H,1H3 |
| InChIKey | RDPMTBYUQPFCPX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|