C26H34FN3O2S — CID 146546515
N-[(2S)-1-[4-(tert-butylamino)sulfanyl-3-fluoroanilino]-1-oxo-3-phenylpropan-2-yl]cyclohexanecarboxamide (PubChem CID 146546515) has the molecular formula C26H34FN3O2S and a molecular weight of 471.64 g/mol. Its IUPAC name is N-[(2S)-1-[4-(tert-butylamino)sulfanyl-3-fluoroanilino]-1-oxo-3-phenylpropan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[(2S)-1-[4-(tert-butylamino)sulfanyl-3-fluoroanilino]-1-oxo-3-phenylpropan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 146546515 |
| Molecular Formula | C26H34FN3O2S |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-[(2S)-1-[4-(tert-butylamino)sulfanyl-3-fluoroanilino]-1-oxo-3-phenylpropan-2-yl]cyclohexanecarboxamide |
| SMILES | CC(C)(C)NSc1ccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)C2CCCCC2)cc1F |
| InChI | InChI=1S/C26H34FN3O2S/c1-26(2,3)30-33-23-15-14-20(17-21(23)27)28-25(32)22(16-18-10-6-4-7-11-18)29-24(31)19-12-8-5-9-13-19/h4,6-7,10-11,14-15,17,19,22,30H,5,8-9,12-13,16H2,1-3H3,(H,28,32)(H,29,31)/t22-/m0/s1 |
| InChIKey | KJCOGIQTHDFSJV-QFIPXVFZSA-N |
| XLogP | 5.47 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|