C24H33N3O2S2 — CID 146544890
N-[(2S)-1-[4-(tert-butylamino)sulfanylanilino]-1-oxo-3-thiophen-2-ylpropan-2-yl]cyclohexanecarboxamide (PubChem CID 146544890) has the molecular formula C24H33N3O2S2 and a molecular weight of 459.68 g/mol. Its IUPAC name is N-[(2S)-1-[4-(tert-butylamino)sulfanylanilino]-1-oxo-3-thiophen-2-ylpropan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[(2S)-1-[4-(tert-butylamino)sulfanylanilino]-1-oxo-3-thiophen-2-ylpropan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 146544890 |
| Molecular Formula | C24H33N3O2S2 |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-[(2S)-1-[4-(tert-butylamino)sulfanylanilino]-1-oxo-3-thiophen-2-ylpropan-2-yl]cyclohexanecarboxamide |
| SMILES | CC(C)(C)NSc1ccc(NC(=O)[C@H](Cc2cccs2)NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H33N3O2S2/c1-24(2,3)27-31-19-13-11-18(12-14-19)25-23(29)21(16-20-10-7-15-30-20)26-22(28)17-8-5-4-6-9-17/h7,10-15,17,21,27H,4-6,8-9,16H2,1-3H3,(H,25,29)(H,26,28)/t21-/m0/s1 |
| InChIKey | KMDJTHMFVPQBDF-NRFANRHFSA-N |
| XLogP | 5.39 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|