C25H27FN4O2S — CID 146544916
N-[(2S)-1-[4-(tert-butylamino)sulfanylanilino]-1-oxo-3-pyridin-3-ylpropan-2-yl]-4-fluorobenzamide (PubChem CID 146544916) has the molecular formula C25H27FN4O2S and a molecular weight of 466.58 g/mol. Its IUPAC name is N-[(2S)-1-[4-(tert-butylamino)sulfanylanilino]-1-oxo-3-pyridin-3-ylpropan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[(2S)-1-[4-(tert-butylamino)sulfanylanilino]-1-oxo-3-pyridin-3-ylpropan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 146544916 |
| Molecular Formula | C25H27FN4O2S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | N-[(2S)-1-[4-(tert-butylamino)sulfanylanilino]-1-oxo-3-pyridin-3-ylpropan-2-yl]-4-fluorobenzamide |
| SMILES | CC(C)(C)NSc1ccc(NC(=O)[C@H](Cc2cccnc2)NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H27FN4O2S/c1-25(2,3)30-33-21-12-10-20(11-13-21)28-24(32)22(15-17-5-4-14-27-16-17)29-23(31)18-6-8-19(26)9-7-18/h4-14,16,22,30H,15H2,1-3H3,(H,28,32)(H,29,31)/t22-/m0/s1 |
| InChIKey | KOQANQMVAMVGNW-QFIPXVFZSA-N |
| XLogP | 4.60 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|