C24H25FN4O2S — CID 156652761
N-[1-[4-(ethylaminosulfanyl)anilino]-1-oxo-3-pyridin-3-ylpropan-2-yl]-4-fluoro-N-methylbenzamide (PubChem CID 156652761) has the molecular formula C24H25FN4O2S and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[1-[4-(ethylaminosulfanyl)anilino]-1-oxo-3-pyridin-3-ylpropan-2-yl]-4-fluoro-N-methylbenzamide.
| Compound Name | N-[1-[4-(ethylaminosulfanyl)anilino]-1-oxo-3-pyridin-3-ylpropan-2-yl]-4-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 156652761 |
| Molecular Formula | C24H25FN4O2S |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-[1-[4-(ethylaminosulfanyl)anilino]-1-oxo-3-pyridin-3-ylpropan-2-yl]-4-fluoro-N-methylbenzamide |
| SMILES | CCNSc1ccc(NC(=O)C(Cc2cccnc2)N(C)C(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H25FN4O2S/c1-3-27-32-21-12-10-20(11-13-21)28-23(30)22(15-17-5-4-14-26-16-17)29(2)24(31)18-6-8-19(25)9-7-18/h4-14,16,22,27H,3,15H2,1-2H3,(H,28,30) |
| InChIKey | DUKOGBVQPXSYDC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|