C28H26F5N3O5 — CID 146546726
(4S)-1-[[4-[(2S)-2,3-dihydroxypropoxy]-2,6-difluorophenyl]methyl]-3,4-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]-4H-quinazoline-7-carboxamide (PubChem CID 146546726) has the molecular formula C28H26F5N3O5 and a molecular weight of 579.52 g/mol. Its IUPAC name is (4S)-1-[[4-[(2S)-2,3-dihydroxypropoxy]-2,6-difluorophenyl]methyl]-3,4-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]-4H-quinazoline-7-carboxamide.
| Compound Name | (4S)-1-[[4-[(2S)-2,3-dihydroxypropoxy]-2,6-difluorophenyl]methyl]-3,4-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]-4H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 146546726 |
| Molecular Formula | C28H26F5N3O5 |
| Molecular Weight | 579.52 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | (4S)-1-[[4-[(2S)-2,3-dihydroxypropoxy]-2,6-difluorophenyl]methyl]-3,4-dimethyl-2-oxo-N-[(2,4,6-trifluorophenyl)methyl]-4H-quinazoline-7-carboxamide |
| SMILES | C[C@H]1c2ccc(C(=O)NCc3c(F)cc(F)cc3F)cc2N(Cc2c(F)cc(OC[C@@H](O)CO)cc2F)C(=O)N1C |
| InChI | InChI=1S/C28H26F5N3O5/c1-14-19-4-3-15(27(39)34-10-20-22(30)6-16(29)7-23(20)31)5-26(19)36(28(40)35(14)2)11-21-24(32)8-18(9-25(21)33)41-13-17(38)12-37/h3-9,14,17,37-38H,10-13H2,1-2H3,(H,34,39)/t14-,17-/m0/s1 |
| InChIKey | RFILHPPGQQONRH-YOEHRIQHSA-N |
| XLogP | 4.18 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |