C26H23F5N3O7P — CID 175599603
[4-[[3,4-dimethyl-2-oxo-7-[(2,4,6-trifluorophenyl)methylcarbamoyl]-4H-quinazolin-1-yl]methyl]-3,5-difluorophenoxy] methyl hydrogen phosphate (PubChem CID 175599603) has the molecular formula C26H23F5N3O7P and a molecular weight of 615.45 g/mol. Its IUPAC name is [4-[[3,4-dimethyl-2-oxo-7-[(2,4,6-trifluorophenyl)methylcarbamoyl]-4H-quinazolin-1-yl]methyl]-3,5-difluorophenoxy] methyl hydrogen phosphate.
| Compound Name | [4-[[3,4-dimethyl-2-oxo-7-[(2,4,6-trifluorophenyl)methylcarbamoyl]-4H-quinazolin-1-yl]methyl]-3,5-difluorophenoxy] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 175599603 |
| Molecular Formula | C26H23F5N3O7P |
| Molecular Weight | 615.45 g/mol |
| Exact Mass | 615.12 |
| IUPAC Name | [4-[[3,4-dimethyl-2-oxo-7-[(2,4,6-trifluorophenyl)methylcarbamoyl]-4H-quinazolin-1-yl]methyl]-3,5-difluorophenoxy] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OOc1cc(F)c(CN2C(=O)N(C)C(C)c3ccc(C(=O)NCc4c(F)cc(F)cc4F)cc32)c(F)c1 |
| InChI | InChI=1S/C26H23F5N3O7P/c1-13-17-5-4-14(25(35)32-11-18-20(28)7-15(27)8-21(18)29)6-24(17)34(26(36)33(13)2)12-19-22(30)9-16(10-23(19)31)40-41-42(37,38)39-3/h4-10,13H,11-12H2,1-3H3,(H,32,35)(H,37,38) |
| InChIKey | MTRWWUDVQYMTEZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|