C15H20N4O3 — CID 14654694
(2S)-N-[(1S)-2-[(2-amino-2-oxoethyl)amino]-2-oxo-1-phenylethyl]pyrrolidine-2-carboxamide (PubChem CID 14654694) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is (2S)-N-[(1S)-2-[(2-amino-2-oxoethyl)amino]-2-oxo-1-phenylethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(1S)-2-[(2-amino-2-oxoethyl)amino]-2-oxo-1-phenylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 14654694 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (2S)-N-[(1S)-2-[(2-amino-2-oxoethyl)amino]-2-oxo-1-phenylethyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H]1CCCN1)c1ccccc1 |
| InChI | InChI=1S/C15H20N4O3/c16-12(20)9-18-15(22)13(10-5-2-1-3-6-10)19-14(21)11-7-4-8-17-11/h1-3,5-6,11,13,17H,4,7-9H2,(H2,16,20)(H,18,22)(H,19,21)/t11-,13-/m0/s1 |
| InChIKey | OHRIFHPVTUDFDC-AAEUAGOBSA-N |
| XLogP | -0.80 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |