C39H33F5N3O5P — CID 146547052
[2,6-dibenzyl-4-[[(4S)-3,4-dimethyl-2-oxo-7-[(2,4,6-trifluorophenyl)methylcarbamoyl]-4H-quinazolin-1-yl]methyl]-3,5-difluorophenyl] dihydrogen phosphite (PubChem CID 146547052) has the molecular formula C39H33F5N3O5P and a molecular weight of 749.67 g/mol. Its IUPAC name is [2,6-dibenzyl-4-[[(4S)-3,4-dimethyl-2-oxo-7-[(2,4,6-trifluorophenyl)methylcarbamoyl]-4H-quinazolin-1-yl]methyl]-3,5-difluorophenyl] dihydrogen phosphite.
| Compound Name | [2,6-dibenzyl-4-[[(4S)-3,4-dimethyl-2-oxo-7-[(2,4,6-trifluorophenyl)methylcarbamoyl]-4H-quinazolin-1-yl]methyl]-3,5-difluorophenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 146547052 |
| Molecular Formula | C39H33F5N3O5P |
| Molecular Weight | 749.67 g/mol |
| Exact Mass | 749.21 |
| IUPAC Name | [2,6-dibenzyl-4-[[(4S)-3,4-dimethyl-2-oxo-7-[(2,4,6-trifluorophenyl)methylcarbamoyl]-4H-quinazolin-1-yl]methyl]-3,5-difluorophenyl] dihydrogen phosphite |
| SMILES | C[C@H]1c2ccc(C(=O)NCc3c(F)cc(F)cc3F)cc2N(Cc2c(F)c(Cc3ccccc3)c(OP(O)O)c(Cc3ccccc3)c2F)C(=O)N1C |
| InChI | InChI=1S/C39H33F5N3O5P/c1-22-27-14-13-25(38(48)45-20-30-32(41)18-26(40)19-33(30)42)17-34(27)47(39(49)46(22)2)21-31-35(43)28(15-23-9-5-3-6-10-23)37(52-53(50)51)29(36(31)44)16-24-11-7-4-8-12-24/h3-14,17-19,22,50-51H,15-16,20-21H2,1-2H3,(H,45,48)/t22-/m0/s1 |
| InChIKey | NABRFIABGJWPAO-QFIPXVFZSA-N |
| XLogP | 8.22 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.67 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|