C33H21N3O — CID 146548816
2-phenyl-5-[4-(10-phenylphenanthridin-6-yl)phenyl]-1,3,4-oxadiazole (PubChem CID 146548816) has the molecular formula C33H21N3O and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-phenyl-5-[4-(10-phenylphenanthridin-6-yl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-phenyl-5-[4-(10-phenylphenanthridin-6-yl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 146548816 |
| Molecular Formula | C33H21N3O |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-phenyl-5-[4-(10-phenylphenanthridin-6-yl)phenyl]-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2nnc(-c3ccc(-c4nc5ccccc5c5c(-c6ccccc6)cccc45)cc3)o2)cc1 |
| InChI | InChI=1S/C33H21N3O/c1-3-10-22(11-4-1)26-15-9-16-28-30(26)27-14-7-8-17-29(27)34-31(28)23-18-20-25(21-19-23)33-36-35-32(37-33)24-12-5-2-6-13-24/h1-21H |
| InChIKey | YQECTOQXAJIRIY-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|