C56H45N3O — CID 146549534
(1Z,4E,6E,8E,10Z)-1-N-benzylidene-4,7,8-trimethyl-1-(6'-quinolin-8-ylspiro[fluorene-9,9'-xanthene]-3'-yl)dodeca-1,4,6,8,10-pentaene-1,3-diimine (PubChem CID 146549534) has the molecular formula C56H45N3O and a molecular weight of 776.00 g/mol. Its IUPAC name is (1Z,4E,6E,8E,10Z)-1-N-benzylidene-4,7,8-trimethyl-1-(6'-quinolin-8-ylspiro[fluorene-9,9'-xanthene]-3'-yl)dodeca-1,4,6,8,10-pentaene-1,3-diimine.
| Compound Name | (1Z,4E,6E,8E,10Z)-1-N-benzylidene-4,7,8-trimethyl-1-(6'-quinolin-8-ylspiro[fluorene-9,9'-xanthene]-3'-yl)dodeca-1,4,6,8,10-pentaene-1,3-diimine |
|---|---|
| PubChem CID | 146549534 |
| Molecular Formula | C56H45N3O |
| Molecular Weight | 776.00 g/mol |
| Exact Mass | 775.36 |
| IUPAC Name | (1Z,4E,6E,8E,10Z)-1-N-benzylidene-4,7,8-trimethyl-1-(6'-quinolin-8-ylspiro[fluorene-9,9'-xanthene]-3'-yl)dodeca-1,4,6,8,10-pentaene-1,3-diimine |
| SMILES | [H]/N=C(/C=C(\N=C\c1ccccc1)c1ccc2c(c1)Oc1cc(-c3cccc4cccnc34)ccc1C21c2ccccc2-c2ccccc21)C(\C)=C\C=C(C)\C(C)=C\C=C/C |
| InChI | InChI=1S/C56H45N3O/c1-5-6-16-37(2)38(3)26-27-39(4)51(57)35-52(59-36-40-17-8-7-9-18-40)43-29-31-50-54(34-43)60-53-33-42(44-23-14-19-41-20-15-32-58-55(41)44)28-30-49(53)56(50)47-24-12-10-21-45(47)46-22-11-13-25-48(46)56/h5-36,57H,1-4H3/b6-5-,37-16+,38-26+,39-27+,52-35-,57-51-,59-36+ |
| InChIKey | CVKJXPQNNBPYTC-QUVUBTDUSA-N |
| XLogP | 14.27 |
| TPSA | 58.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.00 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|