C23H34N4O6 — CID 146550830
(2S)-2-[[2-[(E)-[(5S)-2,3-dihydroxy-5-methoxy-6-methylheptan-4-ylidene]amino]oxyacetyl]amino]-3-(1H-indol-3-yl)-N-methylpropanamide (PubChem CID 146550830) has the molecular formula C23H34N4O6 and a molecular weight of 462.55 g/mol. Its IUPAC name is (2S)-2-[[2-[(E)-[(5S)-2,3-dihydroxy-5-methoxy-6-methylheptan-4-ylidene]amino]oxyacetyl]amino]-3-(1H-indol-3-yl)-N-methylpropanamide.
| Compound Name | (2S)-2-[[2-[(E)-[(5S)-2,3-dihydroxy-5-methoxy-6-methylheptan-4-ylidene]amino]oxyacetyl]amino]-3-(1H-indol-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 146550830 |
| Molecular Formula | C23H34N4O6 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (2S)-2-[[2-[(E)-[(5S)-2,3-dihydroxy-5-methoxy-6-methylheptan-4-ylidene]amino]oxyacetyl]amino]-3-(1H-indol-3-yl)-N-methylpropanamide |
| SMILES | CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CO/N=C(\C(O)C(C)O)[C@@H](OC)C(C)C |
| InChI | InChI=1S/C23H34N4O6/c1-13(2)22(32-5)20(21(30)14(3)28)27-33-12-19(29)26-18(23(31)24-4)10-15-11-25-17-9-7-6-8-16(15)17/h6-9,11,13-14,18,21-22,25,28,30H,10,12H2,1-5H3,(H,24,31)(H,26,29)/b27-20+/t14?,18-,21?,22-/m0/s1 |
| InChIKey | UZCRKBQLJBDTNL-WEDMPNLOSA-N |
| XLogP | 0.73 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|