C22H18ClN3O2 — CID 146552076
ethyl 4-[[4-(2-chloro-4-pyridinyl)phenyl]methyl]pyrrolo[1,2-b]pyridazine-2-carboxylate (PubChem CID 146552076) has the molecular formula C22H18ClN3O2 and a molecular weight of 391.86 g/mol. Its IUPAC name is ethyl 4-[[4-(2-chloro-4-pyridinyl)phenyl]methyl]pyrrolo[1,2-b]pyridazine-2-carboxylate.
| Compound Name | ethyl 4-[[4-(2-chloro-4-pyridinyl)phenyl]methyl]pyrrolo[1,2-b]pyridazine-2-carboxylate |
|---|---|
| PubChem CID | 146552076 |
| Molecular Formula | C22H18ClN3O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | ethyl 4-[[4-(2-chloro-4-pyridinyl)phenyl]methyl]pyrrolo[1,2-b]pyridazine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccc(-c3ccnc(Cl)c3)cc2)c2cccn2n1 |
| InChI | InChI=1S/C22H18ClN3O2/c1-2-28-22(27)19-13-18(20-4-3-11-26(20)25-19)12-15-5-7-16(8-6-15)17-9-10-24-21(23)14-17/h3-11,13-14H,2,12H2,1H3 |
| InChIKey | XVRHLAZXOZPDMW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|