C28H30ClN3O2 — CID 87778969
ethyl 5-[2-benzyl-4-(2-chloro-4-pyridinyl)-7-ethylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate (PubChem CID 87778969) has the molecular formula C28H30ClN3O2 and a molecular weight of 476.02 g/mol. Its IUPAC name is ethyl 5-[2-benzyl-4-(2-chloro-4-pyridinyl)-7-ethylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate.
| Compound Name | ethyl 5-[2-benzyl-4-(2-chloro-4-pyridinyl)-7-ethylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate |
|---|---|
| PubChem CID | 87778969 |
| Molecular Formula | C28H30ClN3O2 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | ethyl 5-[2-benzyl-4-(2-chloro-4-pyridinyl)-7-ethylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1c(Cc2ccccc2)nn2c(CC)ccc2c1-c1ccnc(Cl)c1 |
| InChI | InChI=1S/C28H30ClN3O2/c1-3-22-14-15-25-28(21-16-17-30-26(29)19-21)23(12-8-9-13-27(33)34-4-2)24(31-32(22)25)18-20-10-6-5-7-11-20/h5-7,10-11,14-17,19H,3-4,8-9,12-13,18H2,1-2H3 |
| InChIKey | FQIUJGMOACAJNN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|