C23H26Cl2N2O2 — CID 69311551
ethyl 5-[4-(3,5-dichlorophenyl)-7-ethyl-2-methylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate (PubChem CID 69311551) has the molecular formula C23H26Cl2N2O2 and a molecular weight of 433.38 g/mol. Its IUPAC name is ethyl 5-[4-(3,5-dichlorophenyl)-7-ethyl-2-methylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate.
| Compound Name | ethyl 5-[4-(3,5-dichlorophenyl)-7-ethyl-2-methylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate |
|---|---|
| PubChem CID | 69311551 |
| Molecular Formula | C23H26Cl2N2O2 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | ethyl 5-[4-(3,5-dichlorophenyl)-7-ethyl-2-methylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1c(C)nn2c(CC)ccc2c1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H26Cl2N2O2/c1-4-19-10-11-21-23(16-12-17(24)14-18(25)13-16)20(15(3)26-27(19)21)8-6-7-9-22(28)29-5-2/h10-14H,4-9H2,1-3H3 |
| InChIKey | RIXHFGAVSLJUCM-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|