C26H26ClN3O2 — CID 87581063
ethyl 4-[4-(2-chloro-4-pyridinyl)-7-ethyl-2-phenylpyrrolo[1,2-b]pyridazin-3-yl]butanoate (PubChem CID 87581063) has the molecular formula C26H26ClN3O2 and a molecular weight of 447.97 g/mol. Its IUPAC name is ethyl 4-[4-(2-chloro-4-pyridinyl)-7-ethyl-2-phenylpyrrolo[1,2-b]pyridazin-3-yl]butanoate.
| Compound Name | ethyl 4-[4-(2-chloro-4-pyridinyl)-7-ethyl-2-phenylpyrrolo[1,2-b]pyridazin-3-yl]butanoate |
|---|---|
| PubChem CID | 87581063 |
| Molecular Formula | C26H26ClN3O2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | ethyl 4-[4-(2-chloro-4-pyridinyl)-7-ethyl-2-phenylpyrrolo[1,2-b]pyridazin-3-yl]butanoate |
| SMILES | CCOC(=O)CCCc1c(-c2ccccc2)nn2c(CC)ccc2c1-c1ccnc(Cl)c1 |
| InChI | InChI=1S/C26H26ClN3O2/c1-3-20-13-14-22-25(19-15-16-28-23(27)17-19)21(11-8-12-24(31)32-4-2)26(29-30(20)22)18-9-6-5-7-10-18/h5-7,9-10,13-17H,3-4,8,11-12H2,1-2H3 |
| InChIKey | URSHXMDOTYKREG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|