C24H26BrN3O2 — CID 68802510
ethyl 5-[2-(bromomethyl)-4-(3-cyanophenyl)-7-ethylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate (PubChem CID 68802510) has the molecular formula C24H26BrN3O2 and a molecular weight of 468.40 g/mol. Its IUPAC name is ethyl 5-[2-(bromomethyl)-4-(3-cyanophenyl)-7-ethylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate.
| Compound Name | ethyl 5-[2-(bromomethyl)-4-(3-cyanophenyl)-7-ethylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate |
|---|---|
| PubChem CID | 68802510 |
| Molecular Formula | C24H26BrN3O2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | ethyl 5-[2-(bromomethyl)-4-(3-cyanophenyl)-7-ethylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1c(CBr)nn2c(CC)ccc2c1-c1cccc(C#N)c1 |
| InChI | InChI=1S/C24H26BrN3O2/c1-3-19-12-13-22-24(18-9-7-8-17(14-18)16-26)20(21(15-25)27-28(19)22)10-5-6-11-23(29)30-4-2/h7-9,12-14H,3-6,10-11,15H2,1-2H3 |
| InChIKey | MYCFTRHNJLIADB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|