C28H29ClN2O2 — CID 68802064
ethyl 5-[4-(3-chlorophenyl)-7-ethyl-2-phenylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate (PubChem CID 68802064) has the molecular formula C28H29ClN2O2 and a molecular weight of 461.01 g/mol. Its IUPAC name is ethyl 5-[4-(3-chlorophenyl)-7-ethyl-2-phenylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate.
| Compound Name | ethyl 5-[4-(3-chlorophenyl)-7-ethyl-2-phenylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate |
|---|---|
| PubChem CID | 68802064 |
| Molecular Formula | C28H29ClN2O2 |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | ethyl 5-[4-(3-chlorophenyl)-7-ethyl-2-phenylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1c(-c2ccccc2)nn2c(CC)ccc2c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C28H29ClN2O2/c1-3-23-17-18-25-27(21-13-10-14-22(29)19-21)24(15-8-9-16-26(32)33-4-2)28(30-31(23)25)20-11-6-5-7-12-20/h5-7,10-14,17-19H,3-4,8-9,15-16H2,1-2H3 |
| InChIKey | GVHSPOYCRPPTLH-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|