C21H25ClN2O2S — CID 69308090
ethyl 5-[4-(5-chlorothiophen-2-yl)-7-ethyl-2-methylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate (PubChem CID 69308090) has the molecular formula C21H25ClN2O2S and a molecular weight of 404.96 g/mol. Its IUPAC name is ethyl 5-[4-(5-chlorothiophen-2-yl)-7-ethyl-2-methylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate.
| Compound Name | ethyl 5-[4-(5-chlorothiophen-2-yl)-7-ethyl-2-methylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate |
|---|---|
| PubChem CID | 69308090 |
| Molecular Formula | C21H25ClN2O2S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | ethyl 5-[4-(5-chlorothiophen-2-yl)-7-ethyl-2-methylpyrrolo[1,2-b]pyridazin-3-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1c(C)nn2c(CC)ccc2c1-c1ccc(Cl)s1 |
| InChI | InChI=1S/C21H25ClN2O2S/c1-4-15-10-11-17-21(18-12-13-19(22)27-18)16(14(3)23-24(15)17)8-6-7-9-20(25)26-5-2/h10-13H,4-9H2,1-3H3 |
| InChIKey | ZHSPYPLIHUKIAF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|