C9H10N2O2S2 — CID 146552667
3-(3-ethoxy-5-methylthiophen-2-yl)-2H-1,2,4-oxadiazole-5-thione (PubChem CID 146552667) has the molecular formula C9H10N2O2S2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-(3-ethoxy-5-methylthiophen-2-yl)-2H-1,2,4-oxadiazole-5-thione.
| Compound Name | 3-(3-ethoxy-5-methylthiophen-2-yl)-2H-1,2,4-oxadiazole-5-thione |
|---|---|
| PubChem CID | 146552667 |
| Molecular Formula | C9H10N2O2S2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 3-(3-ethoxy-5-methylthiophen-2-yl)-2H-1,2,4-oxadiazole-5-thione |
| SMILES | CCOc1cc(C)sc1-c1nc(=S)o[nH]1 |
| InChI | InChI=1S/C9H10N2O2S2/c1-3-12-6-4-5(2)15-7(6)8-10-9(14)13-11-8/h4H,3H2,1-2H3,(H,10,11,14) |
| InChIKey | HMROVKOYQGIBFU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|